C9H15N3 — CID 102544556
N,3-dimethyl-5-(methylaminomethyl)pyridin-2-amine (PubChem CID 102544556) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N,3-dimethyl-5-(methylaminomethyl)pyridin-2-amine.
| Compound Name | N,3-dimethyl-5-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102544556 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N,3-dimethyl-5-(methylaminomethyl)pyridin-2-amine |
| SMILES | CNCc1cnc(NC)c(C)c1 |
| InChI | InChI=1S/C9H15N3/c1-7-4-8(5-10-2)6-12-9(7)11-3/h4,6,10H,5H2,1-3H3,(H,11,12) |
| InChIKey | JWVSEFKBCGJUQD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |