About 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine
5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine (PubChem CID 102544679) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine |
| PubChem CID | 102544679 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine |
| SMILES | C=Cc1cnc(N(CC)CC)c(C)c1 |
| InChI | InChI=1S/C12H18N2/c1-5-11-8-10(4)12(13-9-11)14(6-2)7-3/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | JTDIXPXMFAGNRN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine?
The IUPAC name of 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine (CID 102544679) is 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine.
What is the SMILES notation for 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine?
The canonical SMILES for 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine is C=Cc1cnc(N(CC)CC)c(C)c1.
What is the InChIKey of 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine?
The InChIKey is JTDIXPXMFAGNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-5-11-8-10(4)12(13-9-11)14(6-2)7-3/h5,8-9H,1,6-7H2,2-4H3.
What are the key properties of 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine?
5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine has a molecular weight of 190.29 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-N,N-diethyl-3-methylpyridin-2-amine is sourced from PubChem (CID 102544679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).