C11H19N3 — CID 102545296
5-(1-aminoethyl)-4-methyl-N-propylpyridin-2-amine (PubChem CID 102545296) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-(1-aminoethyl)-4-methyl-N-propylpyridin-2-amine.
| Compound Name | 5-(1-aminoethyl)-4-methyl-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 102545296 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-(1-aminoethyl)-4-methyl-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(C)c(C(C)N)cn1 |
| InChI | InChI=1S/C11H19N3/c1-4-5-13-11-6-8(2)10(7-14-11)9(3)12/h6-7,9H,4-5,12H2,1-3H3,(H,13,14) |
| InChIKey | PDSDTRBVCGSFEM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |