C20H41IO3Si — CID 10254752
(E,2R,3R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-iodo-8,10-dimethylundec-10-ene-1,3-diol (PubChem CID 10254752) has the molecular formula C20H41IO3Si and a molecular weight of 484.54 g/mol. Its IUPAC name is (E,2R,3R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-iodo-8,10-dimethylundec-10-ene-1,3-diol.
| Compound Name | (E,2R,3R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-iodo-8,10-dimethylundec-10-ene-1,3-diol |
|---|---|
| PubChem CID | 10254752 |
| Molecular Formula | C20H41IO3Si |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (E,2R,3R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-11-iodo-8,10-dimethylundec-10-ene-1,3-diol |
| SMILES | C/C(=C\I)C[C@H](C)CCCC[C@@H](O)[C@H](CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H41IO3Si/c1-16(12-17(2)13-21)10-8-9-11-19(23)18(14-22)15-24-25(6,7)20(3,4)5/h13,16,18-19,22-23H,8-12,14-15H2,1-7H3/b17-13+/t16-,18-,19-/m1/s1 |
| InChIKey | IORGHZHQGWFMMI-ATZMXTJDSA-N |
| XLogP | 5.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|