C9H3Br3F3NO2S — CID 10254826
2,2,2-trifluoro-N-[(5S,6R)-1,3,5-tribromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl]acetamide (PubChem CID 10254826) has the molecular formula C9H3Br3F3NO2S and a molecular weight of 485.90 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(5S,6R)-1,3,5-tribromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(5S,6R)-1,3,5-tribromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl]acetamide |
|---|---|
| PubChem CID | 10254826 |
| Molecular Formula | C9H3Br3F3NO2S |
| Molecular Weight | 485.90 g/mol |
| Exact Mass | 482.74 |
| IUPAC Name | 2,2,2-trifluoro-N-[(5S,6R)-1,3,5-tribromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl]acetamide |
| SMILES | O=C1c2c(Br)sc(Br)c2[C@@H](NC(=O)C(F)(F)F)[C@@H]1Br |
| InChI | InChI=1S/C9H3Br3F3NO2S/c10-3-4(16-8(18)9(13,14)15)1-2(5(3)17)7(12)19-6(1)11/h3-4H,(H,16,18)/t3-,4+/m0/s1 |
| InChIKey | IFSRPZREBSTVHH-IUYQGCFVSA-N |
| XLogP | 3.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|