C13H16ClN3O2S — CID 102548363
3-chloro-7-(2-methylpiperidin-1-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 102548363) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-chloro-7-(2-methylpiperidin-1-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-chloro-7-(2-methylpiperidin-1-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 102548363 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-chloro-7-(2-methylpiperidin-1-yl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CC1CCCCN1c1ccc2c(c1)S(=O)(=O)N=C(Cl)N2 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-9-4-2-3-7-17(9)10-5-6-11-12(8-10)20(18,19)16-13(14)15-11/h5-6,8-9H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | JHBTXVMNQNKCLL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|