About 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine
1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine (PubChem CID 102549121) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine |
| PubChem CID | 102549121 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine |
| SMILES | NC1CCCN(c2nc3cccnc3s2)C1 |
| InChI | InChI=1S/C11H14N4S/c12-8-3-2-6-15(7-8)11-14-9-4-1-5-13-10(9)16-11/h1,4-5,8H,2-3,6-7,12H2 |
| InChIKey | MLHFWNHJFPCBLC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine?
The IUPAC name of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine (CID 102549121) is 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine.
What is the SMILES notation for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine?
The canonical SMILES for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine is NC1CCCN(c2nc3cccnc3s2)C1.
What is the InChIKey of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine?
The InChIKey is MLHFWNHJFPCBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c12-8-3-2-6-15(7-8)11-14-9-4-1-5-13-10(9)16-11/h1,4-5,8H,2-3,6-7,12H2.
What are the key properties of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine?
1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine has a molecular weight of 234.33 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperidin-3-amine is sourced from PubChem (CID 102549121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).