C11H13N3O2S — CID 102549125
3-piperidin-3-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 102549125) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-piperidin-3-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-piperidin-3-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102549125 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-piperidin-3-yl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2ccsc2c(=O)n1C1CCCNC1 |
| InChI | InChI=1S/C11H13N3O2S/c15-10-9-8(3-5-17-9)13-11(16)14(10)7-2-1-4-12-6-7/h3,5,7,12H,1-2,4,6H2,(H,13,16) |
| InChIKey | OEADSYJLZWJNDY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |