C19H18F6N8O — CID 10254918
(3R)-3-amino-1-[8-(1,2,4-triazol-1-ylmethyl)-2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 10254918) has the molecular formula C19H18F6N8O and a molecular weight of 488.40 g/mol. Its IUPAC name is (3R)-3-amino-1-[8-(1,2,4-triazol-1-ylmethyl)-2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[8-(1,2,4-triazol-1-ylmethyl)-2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 10254918 |
| Molecular Formula | C19H18F6N8O |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (3R)-3-amino-1-[8-(1,2,4-triazol-1-ylmethyl)-2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCn2nc(C(F)(F)F)nc2C1Cn1cncn1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H18F6N8O/c20-12-6-14(22)13(21)4-10(12)3-11(26)5-16(34)32-1-2-33-17(29-18(30-33)19(23,24)25)15(32)7-31-9-27-8-28-31/h4,6,8-9,11,15H,1-3,5,7,26H2/t11-,15?/m1/s1 |
| InChIKey | ALGBOHOONNECEK-ZRKZCGFPSA-N |
| XLogP | 1.85 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|