About 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one
6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one (PubChem CID 102549266) has the molecular formula C12H14FN3O
and a molecular weight of 235.26 g/mol. Its IUPAC name is 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one.
Molecular Properties
| Compound Name | 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one |
| PubChem CID | 102549266 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one |
| SMILES | O=C1NC2(CCCNC2)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C12H14FN3O/c13-8-2-3-10-9(6-8)11(17)16-12(15-10)4-1-5-14-7-12/h2-3,6,14-15H,1,4-5,7H2,(H,16,17) |
| InChIKey | PKIWUMFAPFBZAB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one?
The IUPAC name of 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one (CID 102549266) is 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one.
What is the SMILES notation for 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one?
The canonical SMILES for 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one is O=C1NC2(CCCNC2)Nc2ccc(F)cc21.
What is the InChIKey of 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one?
The InChIKey is PKIWUMFAPFBZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN3O/c13-8-2-3-10-9(6-8)11(17)16-12(15-10)4-1-5-14-7-12/h2-3,6,14-15H,1,4-5,7H2,(H,16,17).
What are the key properties of 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one?
6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one has a molecular weight of 235.26 g/mol, XLogP of 1.06, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[1,3-dihydroquinazoline-2,3'-piperidine]-4-one is sourced from PubChem (CID 102549266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).