C9H9Cl2FO3S — CID 102550189
2,2-dichloro-1-(3-fluorophenyl)-2-methylsulfonylethanol (PubChem CID 102550189) has the molecular formula C9H9Cl2FO3S and a molecular weight of 287.14 g/mol. Its IUPAC name is 2,2-dichloro-1-(3-fluorophenyl)-2-methylsulfonylethanol.
| Compound Name | 2,2-dichloro-1-(3-fluorophenyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 102550189 |
| Molecular Formula | C9H9Cl2FO3S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | 2,2-dichloro-1-(3-fluorophenyl)-2-methylsulfonylethanol |
| SMILES | CS(=O)(=O)C(Cl)(Cl)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C9H9Cl2FO3S/c1-16(14,15)9(10,11)8(13)6-3-2-4-7(12)5-6/h2-5,8,13H,1H3 |
| InChIKey | SPQPNQYAQGQNDD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|