About 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol
1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol (PubChem CID 102550194) has the molecular formula C7H14Cl2O3S
and a molecular weight of 249.16 g/mol. Its IUPAC name is 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol.
Molecular Properties
| Compound Name | 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol |
| PubChem CID | 102550194 |
| Molecular Formula | C7H14Cl2O3S |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol |
| SMILES | CC(C)(C)C(O)C(Cl)(Cl)S(C)(=O)=O |
| InChI | InChI=1S/C7H14Cl2O3S/c1-6(2,3)5(10)7(8,9)13(4,11)12/h5,10H,1-4H3 |
| InChIKey | APVJYLUMNUATSY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol?
The IUPAC name of 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol (CID 102550194) is 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol.
What is the SMILES notation for 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol?
The canonical SMILES for 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol is CC(C)(C)C(O)C(Cl)(Cl)S(C)(=O)=O.
What is the InChIKey of 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol?
The InChIKey is APVJYLUMNUATSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Cl2O3S/c1-6(2,3)5(10)7(8,9)13(4,11)12/h5,10H,1-4H3.
What are the key properties of 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol?
1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol has a molecular weight of 249.16 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-3,3-dimethyl-1-methylsulfonylbutan-2-ol is sourced from PubChem (CID 102550194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).