C10H13Br2NO3S — CID 102550401
1-(4-aminophenyl)-2,2-dibromo-2-ethylsulfonylethanol (PubChem CID 102550401) has the molecular formula C10H13Br2NO3S and a molecular weight of 387.09 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2,2-dibromo-2-ethylsulfonylethanol.
| Compound Name | 1-(4-aminophenyl)-2,2-dibromo-2-ethylsulfonylethanol |
|---|---|
| PubChem CID | 102550401 |
| Molecular Formula | C10H13Br2NO3S |
| Molecular Weight | 387.09 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | 1-(4-aminophenyl)-2,2-dibromo-2-ethylsulfonylethanol |
| SMILES | CCS(=O)(=O)C(Br)(Br)C(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13Br2NO3S/c1-2-17(15,16)10(11,12)9(14)7-3-5-8(13)6-4-7/h3-6,9,14H,2,13H2,1H3 |
| InChIKey | BMKYHAGAKSWMQB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|