C23H20F3N3O6 — CID 10255052
(3S)-4-oxo-3-[[(2S)-2-(4-oxoquinazolin-3-yl)butanoyl]amino]-5-(2,3,6-trifluorophenoxy)pentanoic acid (PubChem CID 10255052) has the molecular formula C23H20F3N3O6 and a molecular weight of 491.42 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[(2S)-2-(4-oxoquinazolin-3-yl)butanoyl]amino]-5-(2,3,6-trifluorophenoxy)pentanoic acid.
| Compound Name | (3S)-4-oxo-3-[[(2S)-2-(4-oxoquinazolin-3-yl)butanoyl]amino]-5-(2,3,6-trifluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 10255052 |
| Molecular Formula | C23H20F3N3O6 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (3S)-4-oxo-3-[[(2S)-2-(4-oxoquinazolin-3-yl)butanoyl]amino]-5-(2,3,6-trifluorophenoxy)pentanoic acid |
| SMILES | CC[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)ccc(F)c1F)n1cnc2ccccc2c1=O |
| InChI | InChI=1S/C23H20F3N3O6/c1-2-17(29-11-27-15-6-4-3-5-12(15)23(29)34)22(33)28-16(9-19(31)32)18(30)10-35-21-14(25)8-7-13(24)20(21)26/h3-8,11,16-17H,2,9-10H2,1H3,(H,28,33)(H,31,32)/t16-,17-/m0/s1 |
| InChIKey | NPNXVHZDYYTULY-IRXDYDNUSA-N |
| XLogP | 2.37 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|