C8H14N2O3S — CID 102551532
1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propylurea (PubChem CID 102551532) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propylurea.
| Compound Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propylurea |
|---|---|
| PubChem CID | 102551532 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-3-propylurea |
| SMILES | CCCNC(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14N2O3S/c1-2-4-9-8(11)10-7-3-5-14(12,13)6-7/h3,5,7H,2,4,6H2,1H3,(H2,9,10,11) |
| InChIKey | YQMSDFSPRUYTKI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |