About 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate
10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate (PubChem CID 10255195) has the molecular formula C31H26O4S
and a molecular weight of 494.61 g/mol. Its IUPAC name is 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate.
Molecular Properties
| Compound Name | 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate |
| PubChem CID | 10255195 |
| Molecular Formula | C31H26O4S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate |
| SMILES | O=C(OCC#CCCCCC#CCS(=O)(=O)c1ccccc1)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C31H26O4S/c32-31(28-19-18-27-22-25-14-10-11-15-26(25)23-29(27)24-28)35-20-12-5-3-1-2-4-6-13-21-36(33,34)30-16-8-7-9-17-30/h7-11,14-19,22-24H,1-4,20-21H2 |
| InChIKey | HUHXMQIXUUPWDV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate?
The IUPAC name of 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate (CID 10255195) is 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate.
What is the SMILES notation for 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate?
The canonical SMILES for 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate is O=C(OCC#CCCCCC#CCS(=O)(=O)c1ccccc1)c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate?
The InChIKey is HUHXMQIXUUPWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26O4S/c32-31(28-19-18-27-22-25-14-10-11-15-26(25)23-29(27)24-28)35-20-12-5-3-1-2-4-6-13-21-36(33,34)30-16-8-7-9-17-30/h7-11,14-19,22-24H,1-4,20-21H2.
What are the key properties of 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate?
10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate has a molecular weight of 494.61 g/mol, XLogP of 6.19, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(benzenesulfonyl)deca-2,8-diynyl anthracene-2-carboxylate is sourced from PubChem (CID 10255195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).