C26H42O5SSi — CID 10255206
[(1S,3aR,4S,6S,8aR)-6-(benzenesulfinyl)-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10255206) has the molecular formula C26H42O5SSi and a molecular weight of 494.77 g/mol. Its IUPAC name is [(1S,3aR,4S,6S,8aR)-6-(benzenesulfinyl)-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aR,4S,6S,8aR)-6-(benzenesulfinyl)-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10255206 |
| Molecular Formula | C26H42O5SSi |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(1S,3aR,4S,6S,8aR)-6-(benzenesulfinyl)-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H](S(=O)c1ccccc1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O5SSi/c1-26(2,3)33(5,6)31-25-18-21(32(27)20-10-8-7-9-11-20)12-13-22-23(25)14-15-24(22)30-19-29-17-16-28-4/h7-13,21-25H,14-19H2,1-6H3/t21-,22-,23-,24+,25+,32?/m1/s1 |
| InChIKey | IQJLFWSLLSAAET-FHTHBJPBSA-N |
| XLogP | 5.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|