C26H33F2NO3 — CID 102552584
3,5-bis(4-fluorophenyl)-7a-(octoxymethyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 102552584) has the molecular formula C26H33F2NO3 and a molecular weight of 445.55 g/mol. Its IUPAC name is 3,5-bis(4-fluorophenyl)-7a-(octoxymethyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 3,5-bis(4-fluorophenyl)-7a-(octoxymethyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 102552584 |
| Molecular Formula | C26H33F2NO3 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 3,5-bis(4-fluorophenyl)-7a-(octoxymethyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CCCCCCCCOCC12COC(c3ccc(F)cc3)N1C(c1ccc(F)cc1)OC2 |
| InChI | InChI=1S/C26H33F2NO3/c1-2-3-4-5-6-7-16-30-17-26-18-31-24(20-8-12-22(27)13-9-20)29(26)25(32-19-26)21-10-14-23(28)15-11-21/h8-15,24-25H,2-7,16-19H2,1H3 |
| InChIKey | CVIAQUAIMWJTQD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|