About cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone
cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 102553692) has the molecular formula C14H22F3NO2
and a molecular weight of 293.33 g/mol. Its IUPAC name is cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 102553692 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCCCCC1)N1CCCC1C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO2/c15-14(16,17)12(19)11-8-5-9-18(11)13(20)10-6-3-1-2-4-7-10/h10-12,19H,1-9H2 |
| InChIKey | UQRQMFHRZAHMKP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone?
The IUPAC name of cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone (CID 102553692) is cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone is O=C(C1CCCCCC1)N1CCCC1C(O)C(F)(F)F.
What is the InChIKey of cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone?
The InChIKey is UQRQMFHRZAHMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F3NO2/c15-14(16,17)12(19)11-8-5-9-18(11)13(20)10-6-3-1-2-4-7-10/h10-12,19H,1-9H2.
What are the key properties of cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone?
cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone has a molecular weight of 293.33 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl-[2-(2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 102553692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).