C16H16F3N3O2S — CID 102553752
3-hydroxy-N-[[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]methyl]thiolane-3-carboxamide (PubChem CID 102553752) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is 3-hydroxy-N-[[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]methyl]thiolane-3-carboxamide.
| Compound Name | 3-hydroxy-N-[[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]methyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 102553752 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-hydroxy-N-[[4-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]methyl]thiolane-3-carboxamide |
| SMILES | O=C(NCc1ccc(-n2ccc(C(F)(F)F)n2)cc1)C1(O)CCSC1 |
| InChI | InChI=1S/C16H16F3N3O2S/c17-16(18,19)13-5-7-22(21-13)12-3-1-11(2-4-12)9-20-14(23)15(24)6-8-25-10-15/h1-5,7,24H,6,8-10H2,(H,20,23) |
| InChIKey | LMVLOTYYKXILIX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |