About N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide
N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide (PubChem CID 102554259) has the molecular formula C16H18N6O
and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide.
Molecular Properties
| Compound Name | N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide |
| PubChem CID | 102554259 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(C)Nc2ncnc3[nH]ncc23)cc1 |
| InChI | InChI=1S/C16H18N6O/c1-3-14(23)21-12-6-4-11(5-7-12)10(2)20-15-13-8-19-22-16(13)18-9-17-15/h4-10H,3H2,1-2H3,(H,21,23)(H2,17,18,19,20,22) |
| InChIKey | OETYZWDVNIPKFQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide?
The IUPAC name of N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide (CID 102554259) is N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide.
What is the SMILES notation for N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide?
The canonical SMILES for N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide is CCC(=O)Nc1ccc(C(C)Nc2ncnc3[nH]ncc23)cc1.
What is the InChIKey of N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide?
The InChIKey is OETYZWDVNIPKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O/c1-3-14(23)21-12-6-4-11(5-7-12)10(2)20-15-13-8-19-22-16(13)18-9-17-15/h4-10H,3H2,1-2H3,(H,21,23)(H2,17,18,19,20,22).
What are the key properties of N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide?
N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide has a molecular weight of 310.36 g/mol, XLogP of 2.87, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[1-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)ethyl]phenyl]propanamide is sourced from PubChem (CID 102554259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).