About 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone
4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone (PubChem CID 102554326) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone.
Molecular Properties
| Compound Name | 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone |
| PubChem CID | 102554326 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone |
| SMILES | O=C(C1CCCC1)N1CC2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H25NO/c18-16(14-3-1-2-4-14)17-10-13-6-11-5-12(7-13)9-15(17)8-11/h11-15H,1-10H2 |
| InChIKey | HOTPWGRXKZIFGH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone?
The IUPAC name of 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone (CID 102554326) is 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone.
What is the SMILES notation for 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone?
The canonical SMILES for 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone is O=C(C1CCCC1)N1CC2CC3CC(C2)CC1C3.
What is the InChIKey of 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone?
The InChIKey is HOTPWGRXKZIFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c18-16(14-3-1-2-4-14)17-10-13-6-11-5-12(7-13)9-15(17)8-11/h11-15H,1-10H2.
What are the key properties of 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone?
4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone has a molecular weight of 247.38 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[4.3.1.13,8]undecan-4-yl(cyclopentyl)methanone is sourced from PubChem (CID 102554326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).