About 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine
1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine (PubChem CID 102554439) has the molecular formula C21H25N5
and a molecular weight of 347.47 g/mol. Its IUPAC name is 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine.
Molecular Properties
| Compound Name | 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine |
| PubChem CID | 102554439 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine |
| SMILES | Cc1cccc(C)c1-n1nnnc1CNC(c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C21H25N5/c1-15-8-6-9-16(2)21(15)26-19(23-24-25-26)14-22-20(18-12-7-13-18)17-10-4-3-5-11-17/h3-6,8-11,18,20,22H,7,12-14H2,1-2H3 |
| InChIKey | DXVLMCZBRNKDFU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine?
The IUPAC name of 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine (CID 102554439) is 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine.
What is the SMILES notation for 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine?
The canonical SMILES for 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine is Cc1cccc(C)c1-n1nnnc1CNC(c1ccccc1)C1CCC1.
What is the InChIKey of 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine?
The InChIKey is DXVLMCZBRNKDFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5/c1-15-8-6-9-16(2)21(15)26-19(23-24-25-26)14-22-20(18-12-7-13-18)17-10-4-3-5-11-17/h3-6,8-11,18,20,22H,7,12-14H2,1-2H3.
What are the key properties of 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine?
1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine has a molecular weight of 347.47 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-N-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-1-phenylmethanamine is sourced from PubChem (CID 102554439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).