About 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 102554466) has the molecular formula C18H24N2O3S
and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| PubChem CID | 102554466 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(NC(=O)C1C2C=CC(C2)C1C(=O)O)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C18H24N2O3S/c1-9(16-20-12(8-24-16)18(2,3)4)19-15(21)13-10-5-6-11(7-10)14(13)17(22)23/h5-6,8-11,13-14H,7H2,1-4H3,(H,19,21)(H,22,23) |
| InChIKey | SKVKXMMKOIRSNH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The IUPAC name of 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CID 102554466) is 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
What is the SMILES notation for 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The canonical SMILES for 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is CC(NC(=O)C1C2C=CC(C2)C1C(=O)O)c1nc(C(C)(C)C)cs1.
What is the InChIKey of 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
The InChIKey is SKVKXMMKOIRSNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O3S/c1-9(16-20-12(8-24-16)18(2,3)4)19-15(21)13-10-5-6-11(7-10)14(13)17(22)23/h5-6,8-11,13-14H,7H2,1-4H3,(H,19,21)(H,22,23).
What are the key properties of 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid?
3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid has a molecular weight of 348.47 g/mol, XLogP of 3.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-tert-butyl-1,3-thiazol-2-yl)ethylcarbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is sourced from PubChem (CID 102554466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).