C27H39N3O6 — CID 10255473
(3S,6R,7R)-N-[6-(hydroxyamino)-6-oxohexyl]-6-(2-methylpropyl)-5,18-dioxo-12-oxa-4-azatricyclo[11.2.2.14,7]octadeca-1(16),13(17),14-triene-3-carboxamide (PubChem CID 10255473) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is (3S,6R,7R)-N-[6-(hydroxyamino)-6-oxohexyl]-6-(2-methylpropyl)-5,18-dioxo-12-oxa-4-azatricyclo[11.2.2.14,7]octadeca-1(16),13(17),14-triene-3-carboxamide.
| Compound Name | (3S,6R,7R)-N-[6-(hydroxyamino)-6-oxohexyl]-6-(2-methylpropyl)-5,18-dioxo-12-oxa-4-azatricyclo[11.2.2.14,7]octadeca-1(16),13(17),14-triene-3-carboxamide |
|---|---|
| PubChem CID | 10255473 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | (3S,6R,7R)-N-[6-(hydroxyamino)-6-oxohexyl]-6-(2-methylpropyl)-5,18-dioxo-12-oxa-4-azatricyclo[11.2.2.14,7]octadeca-1(16),13(17),14-triene-3-carboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N2C(=O)[C@@H]1CCCCOc1ccc(cc1)C[C@H]2C(=O)NCCCCCC(=O)NO |
| InChI | InChI=1S/C27H39N3O6/c1-18(2)16-22-21-8-5-7-15-36-20-12-10-19(11-13-20)17-23(30(26(21)33)27(22)34)25(32)28-14-6-3-4-9-24(31)29-35/h10-13,18,21-23,35H,3-9,14-17H2,1-2H3,(H,28,32)(H,29,31)/t21-,22-,23+/m1/s1 |
| InChIKey | JUOXUGXZWHMIOA-ZLNRFVROSA-N |
| XLogP | 2.99 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|