About 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride
7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride (PubChem CID 102555189) has the molecular formula C8H8BrCl2N
and a molecular weight of 268.97 g/mol. Its IUPAC name is 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride.
Molecular Properties
| Compound Name | 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride |
| PubChem CID | 102555189 |
| Molecular Formula | C8H8BrCl2N |
| Molecular Weight | 268.97 g/mol |
| Exact Mass | 266.92 |
| IUPAC Name | 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride |
| SMILES | Cl.Clc1cc(Br)c2c(c1)CCN2 |
| InChI | InChI=1S/C8H7BrClN.ClH/c9-7-4-6(10)3-5-1-2-11-8(5)7;/h3-4,11H,1-2H2;1H |
| InChIKey | KZIKULURICSDCB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride?
The IUPAC name of 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride (CID 102555189) is 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride.
What is the SMILES notation for 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride?
The canonical SMILES for 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride is Cl.Clc1cc(Br)c2c(c1)CCN2.
What is the InChIKey of 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride?
The InChIKey is KZIKULURICSDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClN.ClH/c9-7-4-6(10)3-5-1-2-11-8(5)7;/h3-4,11H,1-2H2;1H.
What are the key properties of 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride?
7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride has a molecular weight of 268.97 g/mol, XLogP of 3.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-chloro-2,3-dihydro-1H-indole;hydrochloride is sourced from PubChem (CID 102555189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).