About 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide
5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide (PubChem CID 102555238) has the molecular formula C12H17F3N2O2S2
and a molecular weight of 342.41 g/mol. Its IUPAC name is 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide |
| PubChem CID | 102555238 |
| Molecular Formula | C12H17F3N2O2S2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCN(CC(F)(F)F)C2)s1 |
| InChI | InChI=1S/C12H17F3N2O2S2/c1-9-2-3-11(20-9)21(18,19)16-6-10-4-5-17(7-10)8-12(13,14)15/h2-3,10,16H,4-8H2,1H3 |
| InChIKey | DIZAZPUKEVLVDS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide?
The IUPAC name of 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide (CID 102555238) is 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide is Cc1ccc(S(=O)(=O)NCC2CCN(CC(F)(F)F)C2)s1.
What is the InChIKey of 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide?
The InChIKey is DIZAZPUKEVLVDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O2S2/c1-9-2-3-11(20-9)21(18,19)16-6-10-4-5-17(7-10)8-12(13,14)15/h2-3,10,16H,4-8H2,1H3.
What are the key properties of 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide?
5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide has a molecular weight of 342.41 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 102555238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).