About 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea
1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea (PubChem CID 102555264) has the molecular formula C17H27ClN2O3
and a molecular weight of 342.87 g/mol. Its IUPAC name is 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea |
| PubChem CID | 102555264 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea |
| SMILES | O=C(NCC1COCCO1)NCC12CC3CC(CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H27ClN2O3/c18-17-6-12-3-13(7-17)5-16(4-12,10-17)11-20-15(21)19-8-14-9-22-1-2-23-14/h12-14H,1-11H2,(H2,19,20,21) |
| InChIKey | BRMIXKSIKSZKIN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea?
The IUPAC name of 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea (CID 102555264) is 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea.
What is the SMILES notation for 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea?
The canonical SMILES for 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea is O=C(NCC1COCCO1)NCC12CC3CC(CC(Cl)(C3)C1)C2.
What is the InChIKey of 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea?
The InChIKey is BRMIXKSIKSZKIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27ClN2O3/c18-17-6-12-3-13(7-17)5-16(4-12,10-17)11-20-15(21)19-8-14-9-22-1-2-23-14/h12-14H,1-11H2,(H2,19,20,21).
What are the key properties of 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea?
1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea has a molecular weight of 342.87 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-chloro-1-adamantyl)methyl]-3-(1,4-dioxan-2-ylmethyl)urea is sourced from PubChem (CID 102555264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).