C19H27F3O10S — CID 10255549
[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 10255549) has the molecular formula C19H27F3O10S and a molecular weight of 504.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10255549 |
| Molecular Formula | C19H27F3O10S |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OC)O[C@H](COS(=O)(=O)C(F)(F)F)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H27F3O10S/c1-25-11-29-16-15(28-9-13-7-5-4-6-8-13)14(10-31-33(23,24)19(20,21)22)32-18(27-3)17(16)30-12-26-2/h4-8,14-18H,9-12H2,1-3H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | COMYJLSENUYVSA-SFFUCWETSA-N |
| XLogP | 1.79 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|