C22H21N3O4 — CID 102555597
1-(1H-benzimidazol-2-yl)ethyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 102555597) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)ethyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | 1-(1H-benzimidazol-2-yl)ethyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 102555597 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)ethyl 2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(OC(=O)C(C(C)C)N1C(=O)c2ccccc2C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H21N3O4/c1-12(2)18(25-20(26)14-8-4-5-9-15(14)21(25)27)22(28)29-13(3)19-23-16-10-6-7-11-17(16)24-19/h4-13,18H,1-3H3,(H,23,24) |
| InChIKey | WZGDQXVYJUEJNJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|