C16H21N3O3S — CID 102555706
1-(oxan-2-yl)-N-[(2-pyrazol-1-ylphenyl)methyl]methanesulfonamide (PubChem CID 102555706) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-(oxan-2-yl)-N-[(2-pyrazol-1-ylphenyl)methyl]methanesulfonamide.
| Compound Name | 1-(oxan-2-yl)-N-[(2-pyrazol-1-ylphenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 102555706 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-(oxan-2-yl)-N-[(2-pyrazol-1-ylphenyl)methyl]methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCO1)NCc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C16H21N3O3S/c20-23(21,13-15-7-3-4-11-22-15)18-12-14-6-1-2-8-16(14)19-10-5-9-17-19/h1-2,5-6,8-10,15,18H,3-4,7,11-13H2 |
| InChIKey | YHVDWMZLCUSUDL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |