C26H20F6N2O2 — CID 10255627
2-benzyl-3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5,6-dimethylquinazolin-4-one (PubChem CID 10255627) has the molecular formula C26H20F6N2O2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 2-benzyl-3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5,6-dimethylquinazolin-4-one.
| Compound Name | 2-benzyl-3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5,6-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 10255627 |
| Molecular Formula | C26H20F6N2O2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-benzyl-3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5,6-dimethylquinazolin-4-one |
| SMILES | Cc1ccc2nc(Cc3ccccc3)n(-c3cccc(C(O)(C(F)(F)F)C(F)(F)F)c3)c(=O)c2c1C |
| InChI | InChI=1S/C26H20F6N2O2/c1-15-11-12-20-22(16(15)2)23(35)34(21(33-20)13-17-7-4-3-5-8-17)19-10-6-9-18(14-19)24(36,25(27,28)29)26(30,31)32/h3-12,14,36H,13H2,1-2H3 |
| InChIKey | LFZSXBCUOMZDKV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |