C15H24N6O3 — CID 102556543
2-methyl-3-oxo-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboxamide (PubChem CID 102556543) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboxamide.
| Compound Name | 2-methyl-3-oxo-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 102556543 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-methyl-3-oxo-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperazine-1-carboxamide |
| SMILES | CC1C(=O)NCCN1C(=O)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C15H24N6O3/c1-11-13(22)16-7-10-19(11)14(23)17-6-4-9-21-15(24)20-8-3-2-5-12(20)18-21/h11H,2-10H2,1H3,(H,16,22)(H,17,23) |
| InChIKey | FQTWMTVRGVCGLD-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|