C15H24N4OS — CID 102556748
2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 102556748) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102556748 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2,2-dimethyl-3-(2-methylprop-1-enyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)=CC1C(C(=O)NCCc2n[nH]c(=S)n2C)C1(C)C |
| InChI | InChI=1S/C15H24N4OS/c1-9(2)8-10-12(15(10,3)4)13(20)16-7-6-11-17-18-14(21)19(11)5/h8,10,12H,6-7H2,1-5H3,(H,16,20)(H,18,21) |
| InChIKey | VQRQDJHVALQIJT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|