C14H18N4OS2 — CID 102557167
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-[2-(1H-pyrazol-4-yl)piperidin-1-yl]ethanone (PubChem CID 102557167) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-[2-(1H-pyrazol-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-[2-(1H-pyrazol-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 102557167 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-1-[2-(1H-pyrazol-4-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)N1CCCCC1c1cn[nH]c1 |
| InChI | InChI=1S/C14H18N4OS2/c1-9-12(21-14(20)17-9)6-13(19)18-5-3-2-4-11(18)10-7-15-16-8-10/h7-8,11H,2-6H2,1H3,(H,15,16)(H,17,20) |
| InChIKey | GZQUYBYNXUEPOP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|