C21H18ClN5OS — CID 102557392
5-amino-1-[4-[3-(4-chlorophenyl)thiomorpholine-4-carbonyl]phenyl]pyrazole-4-carbonitrile (PubChem CID 102557392) has the molecular formula C21H18ClN5OS and a molecular weight of 423.93 g/mol. Its IUPAC name is 5-amino-1-[4-[3-(4-chlorophenyl)thiomorpholine-4-carbonyl]phenyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[4-[3-(4-chlorophenyl)thiomorpholine-4-carbonyl]phenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102557392 |
| Molecular Formula | C21H18ClN5OS |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 5-amino-1-[4-[3-(4-chlorophenyl)thiomorpholine-4-carbonyl]phenyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ccc(C(=O)N3CCSCC3c3ccc(Cl)cc3)cc2)c1N |
| InChI | InChI=1S/C21H18ClN5OS/c22-17-5-1-14(2-6-17)19-13-29-10-9-26(19)21(28)15-3-7-18(8-4-15)27-20(24)16(11-23)12-25-27/h1-8,12,19H,9-10,13,24H2 |
| InChIKey | MYKGEFDJDYICGZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |