About N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide
N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide (PubChem CID 102557692) has the molecular formula C20H27N3O3
and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide.
Molecular Properties
| Compound Name | N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide |
| PubChem CID | 102557692 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide |
| SMILES | CON(C)C(=O)c1ccc(NC(=O)N2CC3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-22(26-2)19(24)16-3-5-17(6-4-16)21-20(25)23-12-15-8-13-7-14(9-15)11-18(23)10-13/h3-6,13-15,18H,7-12H2,1-2H3,(H,21,25) |
| InChIKey | MOIYJFUDSGUAMR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide?
The IUPAC name of N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide (CID 102557692) is N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide.
What is the SMILES notation for N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide?
The canonical SMILES for N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide is CON(C)C(=O)c1ccc(NC(=O)N2CC3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide?
The InChIKey is MOIYJFUDSGUAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O3/c1-22(26-2)19(24)16-3-5-17(6-4-16)21-20(25)23-12-15-8-13-7-14(9-15)11-18(23)10-13/h3-6,13-15,18H,7-12H2,1-2H3,(H,21,25).
What are the key properties of N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide?
N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide has a molecular weight of 357.45 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[methoxy(methyl)carbamoyl]phenyl]-4-azatricyclo[4.3.1.13,8]undecane-4-carboxamide is sourced from PubChem (CID 102557692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).