About 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea (PubChem CID 102558072) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea.
Molecular Properties
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea |
| PubChem CID | 102558072 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea |
| SMILES | CCC1CCC(CNC(=O)NC2C3CCOC3C2(C)C)CC1 |
| InChI | InChI=1S/C18H32N2O2/c1-4-12-5-7-13(8-6-12)11-19-17(21)20-15-14-9-10-22-16(14)18(15,2)3/h12-16H,4-11H2,1-3H3,(H2,19,20,21) |
| InChIKey | BNAZNRLIZJRSIB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea?
The IUPAC name of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea (CID 102558072) is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea.
What is the SMILES notation for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea?
The canonical SMILES for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea is CCC1CCC(CNC(=O)NC2C3CCOC3C2(C)C)CC1.
What is the InChIKey of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea?
The InChIKey is BNAZNRLIZJRSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-4-12-5-7-13(8-6-12)11-19-17(21)20-15-14-9-10-22-16(14)18(15,2)3/h12-16H,4-11H2,1-3H3,(H2,19,20,21).
What are the key properties of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea?
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea has a molecular weight of 308.47 g/mol, XLogP of 3.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[(4-ethylcyclohexyl)methyl]urea is sourced from PubChem (CID 102558072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).