C29H33N7S — CID 10255821
4,5-dimethyl-2-[4-[4-[(1-methylindol-3-yl)methyl]piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole (PubChem CID 10255821) has the molecular formula C29H33N7S and a molecular weight of 511.70 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-[4-[(1-methylindol-3-yl)methyl]piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole.
| Compound Name | 4,5-dimethyl-2-[4-[4-[(1-methylindol-3-yl)methyl]piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 10255821 |
| Molecular Formula | C29H33N7S |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 4,5-dimethyl-2-[4-[4-[(1-methylindol-3-yl)methyl]piperazin-1-yl]-6,7,8,9-tetrahydropyrimido[4,5-b]indolizin-10-yl]-1,3-thiazole |
| SMILES | Cc1nc(-c2c3n(c4c(N5CCN(Cc6cn(C)c7ccccc67)CC5)ncnc24)CCCC3)sc1C |
| InChI | InChI=1S/C29H33N7S/c1-19-20(2)37-29(32-19)25-24-10-6-7-11-36(24)27-26(25)30-18-31-28(27)35-14-12-34(13-15-35)17-21-16-33(3)23-9-5-4-8-22(21)23/h4-5,8-9,16,18H,6-7,10-15,17H2,1-3H3 |
| InChIKey | PMVVGNMFZIIJHK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |