C14H30N4O — CID 102558441
1-[2-(dimethylamino)ethyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]urea (PubChem CID 102558441) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 102558441 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-ethyl-1-[(1-ethylpyrrolidin-2-yl)methyl]urea |
| SMILES | CCNC(=O)N(CCN(C)C)CC1CCCN1CC |
| InChI | InChI=1S/C14H30N4O/c1-5-15-14(19)18(11-10-16(3)4)12-13-8-7-9-17(13)6-2/h13H,5-12H2,1-4H3,(H,15,19) |
| InChIKey | VJFIDYGLJNBTPM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |