C14H16Cl2N4OS — CID 102558539
2-(2,6-dichlorophenyl)-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]propanamide (PubChem CID 102558539) has the molecular formula C14H16Cl2N4OS and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]propanamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 102558539 |
| Molecular Formula | C14H16Cl2N4OS |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]propanamide |
| SMILES | Cc1n[nH]c(=S)n1CCNC(=O)C(C)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H16Cl2N4OS/c1-8(12-10(15)4-3-5-11(12)16)13(21)17-6-7-20-9(2)18-19-14(20)22/h3-5,8H,6-7H2,1-2H3,(H,17,21)(H,19,22) |
| InChIKey | VCNRCFADORKXIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|