C16H17ClN2O3S — CID 102558711
4-[4-(4-chlorobenzoyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 102558711) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 4-[4-(4-chlorobenzoyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | 4-[4-(4-chlorobenzoyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 102558711 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-[4-(4-chlorobenzoyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(C(=O)N2CCC(C(=O)c3ccc(Cl)cc3)CC2)CS1 |
| InChI | InChI=1S/C16H17ClN2O3S/c17-12-3-1-10(2-4-12)14(20)11-5-7-19(8-6-11)15(21)13-9-23-16(22)18-13/h1-4,11,13H,5-9H2,(H,18,22) |
| InChIKey | NUALFZNGCOKJOY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|