C15H17FN4O2S — CID 102558741
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(3-fluorophenyl)-2-hydroxypropanamide (PubChem CID 102558741) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(3-fluorophenyl)-2-hydroxypropanamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(3-fluorophenyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 102558741 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(3-fluorophenyl)-2-hydroxypropanamide |
| SMILES | CC(O)(C(=O)NCc1n[nH]c(=S)n1C1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H17FN4O2S/c1-15(22,9-3-2-4-10(16)7-9)13(21)17-8-12-18-19-14(23)20(12)11-5-6-11/h2-4,7,11,22H,5-6,8H2,1H3,(H,17,21)(H,19,23) |
| InChIKey | JXMVLKLWFRKHDI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|