About N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide
N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide (PubChem CID 102559038) has the molecular formula C15H17FN2O5S
and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide |
| PubChem CID | 102559038 |
| Molecular Formula | C15H17FN2O5S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide |
| SMILES | CCC(Oc1ccccc1F)C(=O)NS(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C15H17FN2O5S/c1-4-12(22-13-8-6-5-7-11(13)16)15(19)18-24(20,21)14-9(2)17-23-10(14)3/h5-8,12H,4H2,1-3H3,(H,18,19) |
| InChIKey | VHDGMCTYCOYDCO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide (CID 102559038) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide is CCC(Oc1ccccc1F)C(=O)NS(=O)(=O)c1c(C)noc1C.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide?
The InChIKey is VHDGMCTYCOYDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O5S/c1-4-12(22-13-8-6-5-7-11(13)16)15(19)18-24(20,21)14-9(2)17-23-10(14)3/h5-8,12H,4H2,1-3H3,(H,18,19).
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide has a molecular weight of 356.38 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2-(2-fluorophenoxy)butanamide is sourced from PubChem (CID 102559038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).