About 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate
3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 102559251) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate.
Molecular Properties
| Compound Name | 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate |
| PubChem CID | 102559251 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | Cc1nn2cc(CCCOC(=O)C3C4CCCCC43)cnc2c1C |
| InChI | InChI=1S/C19H25N3O2/c1-12-13(2)21-22-11-14(10-20-18(12)22)6-5-9-24-19(23)17-15-7-3-4-8-16(15)17/h10-11,15-17H,3-9H2,1-2H3 |
| InChIKey | ZETNAUPRNKAJBC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate?
The IUPAC name of 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate (CID 102559251) is 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate.
What is the SMILES notation for 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate?
The canonical SMILES for 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate is Cc1nn2cc(CCCOC(=O)C3C4CCCCC43)cnc2c1C.
What is the InChIKey of 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate?
The InChIKey is ZETNAUPRNKAJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-12-13(2)21-22-11-14(10-20-18(12)22)6-5-9-24-19(23)17-15-7-3-4-8-16(15)17/h10-11,15-17H,3-9H2,1-2H3.
What are the key properties of 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate?
3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate has a molecular weight of 327.43 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propyl bicyclo[4.1.0]heptane-7-carboxylate is sourced from PubChem (CID 102559251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).