C19H23NO4S — CID 102559253
(1,1-dioxothian-3-yl) 5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylate (PubChem CID 102559253) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is (1,1-dioxothian-3-yl) 5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylate.
| Compound Name | (1,1-dioxothian-3-yl) 5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylate |
|---|---|
| PubChem CID | 102559253 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (1,1-dioxothian-3-yl) 5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylate |
| SMILES | O=C(OC1CCCS(=O)(=O)C1)c1cccc2c3c([nH]c12)CCCCC3 |
| InChI | InChI=1S/C19H23NO4S/c21-19(24-13-6-5-11-25(22,23)12-13)16-9-4-8-15-14-7-2-1-3-10-17(14)20-18(15)16/h4,8-9,13,20H,1-3,5-7,10-12H2 |
| InChIKey | OKKLNCVCLGVFOE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|