C18H18FNO4 — CID 102559255
oxan-2-ylmethyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate (PubChem CID 102559255) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is oxan-2-ylmethyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate.
| Compound Name | oxan-2-ylmethyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 102559255 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | oxan-2-ylmethyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate |
| SMILES | O=C(OCC1CCCCO1)c1ccc(=O)n(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO4/c19-14-5-7-15(8-6-14)20-11-13(4-9-17(20)21)18(22)24-12-16-3-1-2-10-23-16/h4-9,11,16H,1-3,10,12H2 |
| InChIKey | SCLQDTCEZBVMTQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |