C22H31BrO5SSi — CID 10255938
[(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate (PubChem CID 10255938) has the molecular formula C22H31BrO5SSi and a molecular weight of 515.54 g/mol. Its IUPAC name is [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate.
| Compound Name | [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 10255938 |
| Molecular Formula | C22H31BrO5SSi |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](C)(C)CBr)[C@@H]([C@H](/C=C/CSc2ccccc2)OC(C)=O)O1 |
| InChI | InChI=1S/C22H31BrO5SSi/c1-5-25-21-14-13-20(28-30(3,4)16-23)22(27-21)19(26-17(2)24)12-9-15-29-18-10-7-6-8-11-18/h6-14,19-22H,5,15-16H2,1-4H3/b12-9+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | DIYBJGOTIMIESI-RQIYFONMSA-N |
| XLogP | 5.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|