C13H16F4N2O — CID 102559514
2,3,5,6-tetrafluoro-N-(2-methoxycycloheptyl)pyridin-4-amine (PubChem CID 102559514) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(2-methoxycycloheptyl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(2-methoxycycloheptyl)pyridin-4-amine |
|---|---|
| PubChem CID | 102559514 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(2-methoxycycloheptyl)pyridin-4-amine |
| SMILES | COC1CCCCCC1Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H16F4N2O/c1-20-8-6-4-2-3-5-7(8)18-11-9(14)12(16)19-13(17)10(11)15/h7-8H,2-6H2,1H3,(H,18,19) |
| InChIKey | UTOPCVYIKBLSCL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|