C16H23FN4OS — CID 102559837
3-fluoro-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide (PubChem CID 102559837) has the molecular formula C16H23FN4OS and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | 3-fluoro-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 102559837 |
| Molecular Formula | C16H23FN4OS |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-fluoro-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Cn1c(CCNC(=O)C23CC4CC(CC(F)(C4)C2)C3)n[nH]c1=S |
| InChI | InChI=1S/C16H23FN4OS/c1-21-12(19-20-14(21)23)2-3-18-13(22)15-5-10-4-11(6-15)8-16(17,7-10)9-15/h10-11H,2-9H2,1H3,(H,18,22)(H,20,23) |
| InChIKey | DKBHOTIJOHJMNP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|